C19H19O8P — CID 175540307
[1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-9-oxo-10H-anthracen-2-yl]phosphonic acid (PubChem CID 175540307) has the molecular formula C19H19O8P and a molecular weight of 406.33 g/mol. Its IUPAC name is [1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-9-oxo-10H-anthracen-2-yl]phosphonic acid.
| Compound Name | [1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-9-oxo-10H-anthracen-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 175540307 |
| Molecular Formula | C19H19O8P |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-9-oxo-10H-anthracen-2-yl]phosphonic acid |
| SMILES | O=C1c2ccccc2Cc2ccc(P(=O)(O)O)c(C3O[C@H](CO)[C@@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C19H19O8P/c20-8-12-17(22)18(23)19(27-12)15-13(28(24,25)26)6-5-10-7-9-3-1-2-4-11(9)16(21)14(10)15/h1-6,12,17-20,22-23H,7-8H2,(H2,24,25,26)/t12-,17-,18-,19?/m1/s1 |
| InChIKey | LJDFKHYYBNFELM-NBCYARMLSA-N |
| XLogP | -0.22 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|