C9H12O6 — CID 175547482
1,2-dioxine;pentanedioic acid (PubChem CID 175547482) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is 1,2-dioxine;pentanedioic acid.
| Compound Name | 1,2-dioxine;pentanedioic acid |
|---|---|
| PubChem CID | 175547482 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1,2-dioxine;pentanedioic acid |
| SMILES | C1=COOC=C1.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C5H8O4.C4H4O2/c6-4(7)2-1-3-5(8)9;1-2-4-6-5-3-1/h1-3H2,(H,6,7)(H,8,9);1-4H |
| InChIKey | SATVAINZYBIZLM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|