1,2-dioxine;pentanedioic acid

C9H12O6 — CID 175547482

IUPAC1,2-dioxine;pentanedioic acid
SMILESC1=COOC=C1.O=C(O)CCCC(=O)O
InChIInChI=1S/C5H8O4.C4H4O2/c6-4(7)2-1-3-5(8)9;1-2-4-6-5-3-1/h1-3H2,(H,6,7)(H,8,9);1-4H
InChIKeySATVAINZYBIZLM-UHFFFAOYSA-N
MW216.19 g/mol
LogP1.30
Rot. Bonds4

About 1,2-dioxine;pentanedioic acid

1,2-dioxine;pentanedioic acid (PubChem CID 175547482) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is 1,2-dioxine;pentanedioic acid.

Molecular Properties

Compound Name1,2-dioxine;pentanedioic acid
PubChem CID175547482
Molecular FormulaC9H12O6
Molecular Weight216.19 g/mol
Exact Mass216.06
IUPAC Name1,2-dioxine;pentanedioic acid
SMILESC1=COOC=C1.O=C(O)CCCC(=O)O
InChIInChI=1S/C5H8O4.C4H4O2/c6-4(7)2-1-3-5(8)9;1-2-4-6-5-3-1/h1-3H2,(H,6,7)(H,8,9);1-4H
InChIKeySATVAINZYBIZLM-UHFFFAOYSA-N
XLogP1.30
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.19
LogP ≤ 51.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 1,2-dioxine;pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dioxine;pentanedioic acid?
The IUPAC name of 1,2-dioxine;pentanedioic acid (CID 175547482) is 1,2-dioxine;pentanedioic acid.
What is the SMILES notation for 1,2-dioxine;pentanedioic acid?
The canonical SMILES for 1,2-dioxine;pentanedioic acid is C1=COOC=C1.O=C(O)CCCC(=O)O.
What is the InChIKey of 1,2-dioxine;pentanedioic acid?
The InChIKey is SATVAINZYBIZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.C4H4O2/c6-4(7)2-1-3-5(8)9;1-2-4-6-5-3-1/h1-3H2,(H,6,7)(H,8,9);1-4H.
What are the key properties of 1,2-dioxine;pentanedioic acid?
1,2-dioxine;pentanedioic acid has a molecular weight of 216.19 g/mol, XLogP of 1.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dioxine;pentanedioic acid is sourced from PubChem (CID 175547482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).