C13H16NO+ — CID 175622677
2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl-trimethylazanium (PubChem CID 175622677) has the molecular formula C13H16NO+ and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl-trimethylazanium.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl-trimethylazanium |
|---|---|
| PubChem CID | 175622677 |
| Molecular Formula | C13H16NO+ |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)ethynyl-trimethylazanium |
| SMILES | C[N+](C)(C)C#Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C13H16NO/c1-14(2,3)8-6-11-4-5-13-12(10-11)7-9-15-13/h4-5,10H,7,9H2,1-3H3/q+1 |
| InChIKey | DRMZOZGSYICGOM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|