C22H32N2O7 — CID 175632702
(2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-[2-(cyclohexylmethylamino)-2-oxoethoxy]ethyl]cyclopropen-1-yl]ethoxy]acetate (PubChem CID 175632702) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-[2-(cyclohexylmethylamino)-2-oxoethoxy]ethyl]cyclopropen-1-yl]ethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-[2-(cyclohexylmethylamino)-2-oxoethoxy]ethyl]cyclopropen-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 175632702 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-[2-(cyclohexylmethylamino)-2-oxoethoxy]ethyl]cyclopropen-1-yl]ethoxy]acetate |
| SMILES | O=C(COCCC1=C(CCOCC(=O)ON2C(=O)CCC2=O)C1)NCC1CCCCC1 |
| InChI | InChI=1S/C22H32N2O7/c25-19(23-13-16-4-2-1-3-5-16)14-29-10-8-17-12-18(17)9-11-30-15-22(28)31-24-20(26)6-7-21(24)27/h16H,1-15H2,(H,23,25) |
| InChIKey | XPBBDKXYEOUNSP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|