C40H75NO9 — CID 175636989
2-hexyldecyl 6-[[6-[2,2-bis(acetyloxymethyl)butoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate (PubChem CID 175636989) has the molecular formula C40H75NO9 and a molecular weight of 714.04 g/mol. Its IUPAC name is 2-hexyldecyl 6-[[6-[2,2-bis(acetyloxymethyl)butoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[[6-[2,2-bis(acetyloxymethyl)butoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 175636989 |
| Molecular Formula | C40H75NO9 |
| Molecular Weight | 714.04 g/mol |
| Exact Mass | 713.54 |
| IUPAC Name | 2-hexyldecyl 6-[[6-[2,2-bis(acetyloxymethyl)butoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCO)CCCCCC(=O)OCC(CC)(COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C40H75NO9/c1-6-9-11-13-14-18-24-37(23-17-12-10-7-2)31-47-38(45)25-19-15-21-27-41(29-30-42)28-22-16-20-26-39(46)50-34-40(8-3,32-48-35(4)43)33-49-36(5)44/h37,42H,6-34H2,1-5H3 |
| InChIKey | SYUMVAFTSXJEPA-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.04 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|