C20H35N — CID 175639588
(2E,5E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5-dien-1-amine (PubChem CID 175639588) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (2E,5E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5-dien-1-amine.
| Compound Name | (2E,5E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5-dien-1-amine |
|---|---|
| PubChem CID | 175639588 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (2E,5E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5-dien-1-amine |
| SMILES | CC1=C(CCC(C)/C=C/C/C(C)=C/CN)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H35N/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8,13,16H,7,9-12,14-15,21H2,1-5H3/b8-6+,17-13+ |
| InChIKey | PPURJVFACFWFIN-SMEOYZNOSA-N |
| XLogP | 5.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|