C33H20BrN3O3S — CID 175679421
3-[2-[2-(5-bromo-2-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 175679421) has the molecular formula C33H20BrN3O3S and a molecular weight of 618.51 g/mol. Its IUPAC name is 3-[2-[2-(5-bromo-2-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-[2-(5-bromo-2-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 175679421 |
| Molecular Formula | C33H20BrN3O3S |
| Molecular Weight | 618.51 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | 3-[2-[2-(5-bromo-2-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1csc(-n2c(-c3cc(Br)ccc3O)nc(-c3ccccc3)c2-c2ccccc2)n1 |
| InChI | InChI=1S/C33H20BrN3O3S/c34-23-15-16-27(38)25(18-23)31-36-29(20-9-3-1-4-10-20)30(21-11-5-2-6-12-21)37(31)33-35-26(19-41-33)24-17-22-13-7-8-14-28(22)40-32(24)39/h1-19,38H |
| InChIKey | VFNLUMLRFCWTHW-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.51 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|