C16H17O7PS — CID 175695056
3-bis(phenylperoxy)phosphorylthiolane 1,1-dioxide (PubChem CID 175695056) has the molecular formula C16H17O7PS and a molecular weight of 384.35 g/mol. Its IUPAC name is 3-bis(phenylperoxy)phosphorylthiolane 1,1-dioxide.
| Compound Name | 3-bis(phenylperoxy)phosphorylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 175695056 |
| Molecular Formula | C16H17O7PS |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 3-bis(phenylperoxy)phosphorylthiolane 1,1-dioxide |
| SMILES | O=P(OOc1ccccc1)(OOc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H17O7PS/c17-24(16-11-12-25(18,19)13-16,22-20-14-7-3-1-4-8-14)23-21-15-9-5-2-6-10-15/h1-10,16H,11-13H2 |
| InChIKey | MPLNJNDIOFAFLU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|