C21H22O — CID 175695788
3-methoxy-5-phenyl-1-(2-phenylethyl)cyclohexa-1,3-diene (PubChem CID 175695788) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-methoxy-5-phenyl-1-(2-phenylethyl)cyclohexa-1,3-diene.
| Compound Name | 3-methoxy-5-phenyl-1-(2-phenylethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175695788 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-methoxy-5-phenyl-1-(2-phenylethyl)cyclohexa-1,3-diene |
| SMILES | COC1=CC(c2ccccc2)CC(CCc2ccccc2)=C1 |
| InChI | InChI=1S/C21H22O/c1-22-21-15-18(13-12-17-8-4-2-5-9-17)14-20(16-21)19-10-6-3-7-11-19/h2-11,15-16,20H,12-14H2,1H3 |
| InChIKey | YHLXXJOHNJDNFF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |