C17H22O4 — CID 174712862
1,2,3-trimethoxy-5-(2-phenylethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 174712862) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-(2-phenylethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1,2,3-trimethoxy-5-(2-phenylethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 174712862 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1,2,3-trimethoxy-5-(2-phenylethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | COC1=C(OC)C(O)(OC)CC(CCc2ccccc2)=C1 |
| InChI | InChI=1S/C17H22O4/c1-19-15-11-14(10-9-13-7-5-4-6-8-13)12-17(18,21-3)16(15)20-2/h4-8,11,18H,9-10,12H2,1-3H3 |
| InChIKey | WEABMEJCTBXMDI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|