C6H2F10I2O — CID 175702758
1,1,2,2,3,3-hexafluoro-1-iodo-3-(1,1,3,3-tetrafluoro-3-iodopropoxy)propane (PubChem CID 175702758) has the molecular formula C6H2F10I2O and a molecular weight of 533.87 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1-iodo-3-(1,1,3,3-tetrafluoro-3-iodopropoxy)propane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1-iodo-3-(1,1,3,3-tetrafluoro-3-iodopropoxy)propane |
|---|---|
| PubChem CID | 175702758 |
| Molecular Formula | C6H2F10I2O |
| Molecular Weight | 533.87 g/mol |
| Exact Mass | 533.80 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1-iodo-3-(1,1,3,3-tetrafluoro-3-iodopropoxy)propane |
| SMILES | FC(F)(I)CC(F)(F)OC(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C6H2F10I2O/c7-2(8,17)1-3(9,10)19-6(15,16)4(11,12)5(13,14)18/h1H2 |
| InChIKey | ITNIXNGHDJPJHQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.87 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|