C24H23NO6S2 — CID 175715967
3,4-bis-(4-methylphenyl)sulfonyl-2-propanoylbenzamide (PubChem CID 175715967) has the molecular formula C24H23NO6S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3,4-bis-(4-methylphenyl)sulfonyl-2-propanoylbenzamide.
| Compound Name | 3,4-bis-(4-methylphenyl)sulfonyl-2-propanoylbenzamide |
|---|---|
| PubChem CID | 175715967 |
| Molecular Formula | C24H23NO6S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3,4-bis-(4-methylphenyl)sulfonyl-2-propanoylbenzamide |
| SMILES | CCC(=O)c1c(C(N)=O)ccc(S(=O)(=O)c2ccc(C)cc2)c1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H23NO6S2/c1-4-20(26)22-19(24(25)27)13-14-21(32(28,29)17-9-5-15(2)6-10-17)23(22)33(30,31)18-11-7-16(3)8-12-18/h5-14H,4H2,1-3H3,(H2,25,27) |
| InChIKey | YTTQVQFEXFGIHT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |