C16H13N3O — CID 175745364
4,6-dicyano-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 175745364) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 4,6-dicyano-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 4,6-dicyano-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 175745364 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4,6-dicyano-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | CC1(C#N)C(c2ccccc2)=C(C#N)C=CC1C(N)=O |
| InChI | InChI=1S/C16H13N3O/c1-16(10-18)13(15(19)20)8-7-12(9-17)14(16)11-5-3-2-4-6-11/h2-8,13H,1H3,(H2,19,20) |
| InChIKey | RNJUTWOPEDXGPX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |