C11H21NO4 — CID 175759991
3-hydroxy-4-oxo-3-[2,2,2-trideuterio-1-(trimethylazaniumyl)ethyl]hexanoate (PubChem CID 175759991) has the molecular formula C11H21NO4 and a molecular weight of 234.31 g/mol. Its IUPAC name is 3-hydroxy-4-oxo-3-[2,2,2-trideuterio-1-(trimethylazaniumyl)ethyl]hexanoate.
| Compound Name | 3-hydroxy-4-oxo-3-[2,2,2-trideuterio-1-(trimethylazaniumyl)ethyl]hexanoate |
|---|---|
| PubChem CID | 175759991 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 3-hydroxy-4-oxo-3-[2,2,2-trideuterio-1-(trimethylazaniumyl)ethyl]hexanoate |
| SMILES | [2H]C([2H])([2H])C(C(O)(CC(=O)[O-])C(=O)CC)[N+](C)(C)C |
| InChI | InChI=1S/C11H21NO4/c1-6-9(13)11(16,7-10(14)15)8(2)12(3,4)5/h8,16H,6-7H2,1-5H3/i2D3 |
| InChIKey | UUCDSIGKWSWFMJ-BMSJAHLVSA-N |
| XLogP | -1.07 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|