About [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate
[(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate (PubChem CID 175838483) has the molecular formula C11H20F2N2O2
and a molecular weight of 250.29 g/mol. Its IUPAC name is [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate.
Molecular Properties
| Compound Name | [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate |
| PubChem CID | 175838483 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate |
| SMILES | CC(C)(C)N1CCC[C@@H](OC(N)=O)[C@H]1C(F)F |
| InChI | InChI=1S/C11H20F2N2O2/c1-11(2,3)15-6-4-5-7(17-10(14)16)8(15)9(12)13/h7-9H,4-6H2,1-3H3,(H2,14,16)/t7-,8+/m1/s1 |
| InChIKey | DKKQYWMZKFKKKR-SFYZADRCSA-N |
| XLogP | 1.98 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate?
The IUPAC name of [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate (CID 175838483) is [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate.
What is the SMILES notation for [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate?
The canonical SMILES for [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate is CC(C)(C)N1CCC[C@@H](OC(N)=O)[C@H]1C(F)F.
What is the InChIKey of [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate?
The InChIKey is DKKQYWMZKFKKKR-SFYZADRCSA-N. The full InChI is InChI=1S/C11H20F2N2O2/c1-11(2,3)15-6-4-5-7(17-10(14)16)8(15)9(12)13/h7-9H,4-6H2,1-3H3,(H2,14,16)/t7-,8+/m1/s1.
What are the key properties of [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate?
[(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate has a molecular weight of 250.29 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-1-tert-butyl-2-(difluoromethyl)piperidin-3-yl] carbamate is sourced from PubChem (CID 175838483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).