C30H39N4O7P — CID 175866235
3-[3-(diethoxyphosphorylmethyl)-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione (PubChem CID 175866235) has the molecular formula C30H39N4O7P and a molecular weight of 598.64 g/mol. Its IUPAC name is 3-[3-(diethoxyphosphorylmethyl)-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione.
| Compound Name | 3-[3-(diethoxyphosphorylmethyl)-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175866235 |
| Molecular Formula | C30H39N4O7P |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 3-[3-(diethoxyphosphorylmethyl)-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
| SMILES | CCOP(=O)(Cn1c(=O)n(C2CCC(=O)N(Cc3ccc(OC)cc3)C2=O)c2ccc(C3CCNCC3)cc21)OCC |
| InChI | InChI=1S/C30H39N4O7P/c1-4-40-42(38,41-5-2)20-33-27-18-23(22-14-16-31-17-15-22)8-11-25(27)34(30(33)37)26-12-13-28(35)32(29(26)36)19-21-6-9-24(39-3)10-7-21/h6-11,18,22,26,31H,4-5,12-17,19-20H2,1-3H3 |
| InChIKey | PVMOGAOHTNUTIU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|