C20H21FN4O4 — CID 175895576
ethyl 1-[5-[2-(dimethylamino)ethoxy]pyrazin-2-yl]-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 175895576) has the molecular formula C20H21FN4O4 and a molecular weight of 400.41 g/mol. Its IUPAC name is ethyl 1-[5-[2-(dimethylamino)ethoxy]pyrazin-2-yl]-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-[5-[2-(dimethylamino)ethoxy]pyrazin-2-yl]-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 175895576 |
| Molecular Formula | C20H21FN4O4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl 1-[5-[2-(dimethylamino)ethoxy]pyrazin-2-yl]-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cnc(OCCN(C)C)cn2)c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C20H21FN4O4/c1-4-28-20(27)15-12-25(16-6-5-13(21)9-14(16)19(15)26)17-10-23-18(11-22-17)29-8-7-24(2)3/h5-6,9-12H,4,7-8H2,1-3H3 |
| InChIKey | LAXPFYUFLXBYSH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |