C16H22O5 — CID 175912439
3-(3,4-dimethoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 175912439) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 175912439 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | COc1ccc(C2COC3(CCC(O)CC3)O2)cc1OC |
| InChI | InChI=1S/C16H22O5/c1-18-13-4-3-11(9-14(13)19-2)15-10-20-16(21-15)7-5-12(17)6-8-16/h3-4,9,12,15,17H,5-8,10H2,1-2H3 |
| InChIKey | YMUHJIBGBDVPCD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |