C30H30N2O5 — CID 175916126
(E)-3-[4-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 175916126) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is (E)-3-[4-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175916126 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (E)-3-[4-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(C(=O)N3CCN(Cc4ccccc4)C34COC4)cc2)cc1OC |
| InChI | InChI=1S/C30H30N2O5/c1-35-27-15-13-25(18-28(27)36-2)26(33)14-10-22-8-11-24(12-9-22)29(34)32-17-16-31(30(32)20-37-21-30)19-23-6-4-3-5-7-23/h3-15,18H,16-17,19-21H2,1-2H3/b14-10+ |
| InChIKey | OHJFXZQUSCOORH-GXDHUFHOSA-N |
| XLogP | 4.28 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|