C28H25F2N5O3S — CID 175937768
N-(4-carbamimidoylthiophen-2-yl)-2-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 175937768) has the molecular formula C28H25F2N5O3S and a molecular weight of 549.60 g/mol. Its IUPAC name is N-(4-carbamimidoylthiophen-2-yl)-2-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(4-carbamimidoylthiophen-2-yl)-2-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 175937768 |
| Molecular Formula | C28H25F2N5O3S |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | N-(4-carbamimidoylthiophen-2-yl)-2-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(NC(=O)C2CC3(C)CC3N2C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)c1 |
| InChI | InChI=1S/C28H25F2N5O3S/c1-27-10-20(26(38)34-22-9-15(13-39-22)24(31)32)35(21(27)11-27)23(36)12-33-25(37)14-6-7-19-17(8-14)16-4-2-3-5-18(16)28(19,29)30/h2-9,13,20-21H,10-12H2,1H3,(H3,31,32)(H,33,37)(H,34,38) |
| InChIKey | FVNQZBRZTBCOMO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|