C12H19BO4 — CID 175940537
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[1.1.1]pentane-1-carboxylic acid (PubChem CID 175940537) has the molecular formula C12H19BO4 and a molecular weight of 238.09 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[1.1.1]pentane-1-carboxylic acid.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[1.1.1]pentane-1-carboxylic acid |
|---|---|
| PubChem CID | 175940537 |
| Molecular Formula | C12H19BO4 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| SMILES | CC1(C)OB(C2C3CC2(C(=O)O)C3)OC1(C)C |
| InChI | InChI=1S/C12H19BO4/c1-10(2)11(3,4)17-13(16-10)8-7-5-12(8,6-7)9(14)15/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | CGWFOPJVQZXHBF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|