C17H12ClF3N4O2 — CID 175956962
N'-(3-benzyl-4-chlorooxadiazol-3-ium-5-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 175956962) has the molecular formula C17H12ClF3N4O2 and a molecular weight of 396.76 g/mol. Its IUPAC name is N'-(3-benzyl-4-chlorooxadiazol-3-ium-5-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-(3-benzyl-4-chlorooxadiazol-3-ium-5-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 175956962 |
| Molecular Formula | C17H12ClF3N4O2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N'-(3-benzyl-4-chlorooxadiazol-3-ium-5-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | [O-]C(=Nc1on[n+](Cc2ccccc2)c1Cl)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12ClF3N4O2/c18-14-15(27-24-25(14)10-11-5-2-1-3-6-11)23-16(26)22-13-8-4-7-12(9-13)17(19,20)21/h1-9H,10H2,(H-,22,23,24,26) |
| InChIKey | PETUHECEWHWOMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|