C10H10O2 — CID 175961395
6-ethenyl-4H-1,3-benzodioxine (PubChem CID 175961395) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 6-ethenyl-4H-1,3-benzodioxine.
| Compound Name | 6-ethenyl-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 175961395 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 6-ethenyl-4H-1,3-benzodioxine |
| SMILES | C=Cc1ccc2c(c1)COCO2 |
| InChI | InChI=1S/C10H10O2/c1-2-8-3-4-10-9(5-8)6-11-7-12-10/h2-5H,1,6-7H2 |
| InChIKey | RGWLKIRNTGUYDQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |