C10H11NO — CID 141192559
6-ethenyl-3,4-dihydro-2H-1,3-benzoxazine (PubChem CID 141192559) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 6-ethenyl-3,4-dihydro-2H-1,3-benzoxazine.
| Compound Name | 6-ethenyl-3,4-dihydro-2H-1,3-benzoxazine |
|---|---|
| PubChem CID | 141192559 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 6-ethenyl-3,4-dihydro-2H-1,3-benzoxazine |
| SMILES | C=Cc1ccc2c(c1)CNCO2 |
| InChI | InChI=1S/C10H11NO/c1-2-8-3-4-10-9(5-8)6-11-7-12-10/h2-5,11H,1,6-7H2 |
| InChIKey | GIZRWLJELCCVTN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |