C15H13FN2O2 — CID 175995912
1'-but-2-ynyl-6-fluorospiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione (PubChem CID 175995912) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is 1'-but-2-ynyl-6-fluorospiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione.
| Compound Name | 1'-but-2-ynyl-6-fluorospiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione |
|---|---|
| PubChem CID | 175995912 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1'-but-2-ynyl-6-fluorospiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione |
| SMILES | CC#CCN1CCC2(NC(=O)c3cc(F)ccc32)C1=O |
| InChI | InChI=1S/C15H13FN2O2/c1-2-3-7-18-8-6-15(14(18)20)12-5-4-10(16)9-11(12)13(19)17-15/h4-5,9H,6-8H2,1H3,(H,17,19) |
| InChIKey | QXKCROIVFLZYJP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|