C4H7N5 — CID 176519852
2,4,6,8,9-pentazabicyclo[3.3.1]nona-2,6-diene (PubChem CID 176519852) has the molecular formula C4H7N5 and a molecular weight of 125.13 g/mol. Its IUPAC name is 2,4,6,8,9-pentazabicyclo[3.3.1]nona-2,6-diene.
| Compound Name | 2,4,6,8,9-pentazabicyclo[3.3.1]nona-2,6-diene |
|---|---|
| PubChem CID | 176519852 |
| Molecular Formula | C4H7N5 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | 2,4,6,8,9-pentazabicyclo[3.3.1]nona-2,6-diene |
| SMILES | C1=NC2NC=NC(N1)N2 |
| InChI | InChI=1S/C4H7N5/c1-5-3-7-2-8-4(6-1)9-3/h1-4,9H,(H,5,6)(H,7,8) |
| InChIKey | FNYBUQIOLQYUFB-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |