C12H18ClN5O3 — CID 176528711
2-carbamimidoyl-1,1-dimethylguanidine;(4-chlorophenyl) ethaneperoxoate (PubChem CID 176528711) has the molecular formula C12H18ClN5O3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;(4-chlorophenyl) ethaneperoxoate.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;(4-chlorophenyl) ethaneperoxoate |
|---|---|
| PubChem CID | 176528711 |
| Molecular Formula | C12H18ClN5O3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;(4-chlorophenyl) ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(Cl)cc1.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C8H7ClO3.C4H11N5/c1-6(10)11-12-8-4-2-7(9)3-5-8;1-9(2)4(7)8-3(5)6/h2-5H,1H3;1-2H3,(H5,5,6,7,8) |
| InChIKey | BAEWBCSUBHLFSI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|