C21H30N2 — CID 176531753
acetylene;(2E)-N'-[(5Z)-2-methylhepta-2,3,5-trienyl]-N-propan-2-yl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide (PubChem CID 176531753) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is acetylene;(2E)-N'-[(5Z)-2-methylhepta-2,3,5-trienyl]-N-propan-2-yl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide.
| Compound Name | acetylene;(2E)-N'-[(5Z)-2-methylhepta-2,3,5-trienyl]-N-propan-2-yl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 176531753 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | acetylene;(2E)-N'-[(5Z)-2-methylhepta-2,3,5-trienyl]-N-propan-2-yl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
| SMILES | C#C.C=C/C=C(\C=C/C)C(=N/CC(C)=C=C/C=C\C)/NC(C)C |
| InChI | InChI=1S/C19H28N2.C2H2/c1-7-10-11-14-17(6)15-20-19(21-16(4)5)18(12-8-2)13-9-3;1-2/h7-13,16H,2,15H2,1,3-6H3,(H,20,21);1-2H/b10-7-,13-9-,18-12+; |
| InChIKey | VCFOMMKDAQNFPR-UIEOLNHKSA-N |
| XLogP | 5.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|