C20H30N2 — CID 176535548
(2Z,4Z)-N'-[(3Z)-4-ethylhexa-3,5-dien-3-yl]-4-ethylidene-6-methylnona-2,7,8-trienimidamide (PubChem CID 176535548) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (2Z,4Z)-N'-[(3Z)-4-ethylhexa-3,5-dien-3-yl]-4-ethylidene-6-methylnona-2,7,8-trienimidamide.
| Compound Name | (2Z,4Z)-N'-[(3Z)-4-ethylhexa-3,5-dien-3-yl]-4-ethylidene-6-methylnona-2,7,8-trienimidamide |
|---|---|
| PubChem CID | 176535548 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (2Z,4Z)-N'-[(3Z)-4-ethylhexa-3,5-dien-3-yl]-4-ethylidene-6-methylnona-2,7,8-trienimidamide |
| SMILES | C=C=CC(C)CC(/C=C\C(N)=N\C(CC)=C(/C=C)CC)=C/C |
| InChI | InChI=1S/C20H30N2/c1-7-12-16(6)15-17(8-2)13-14-20(21)22-19(11-5)18(9-3)10-4/h8-9,12-14,16H,1,3,10-11,15H2,2,4-6H3,(H2,21,22)/b14-13-,17-8+,19-18+ |
| InChIKey | JPXSEFTYUNOGIC-QPAKBAHRSA-N |
| XLogP | 5.47 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|