C17H43N5O3 — CID 176542682
1,1-dimethyl-3-(N'-methylcarbamimidoyl)guanidine;methane;(3R,4R,5R,6S)-3-methylnonane-4,5,6-triol (PubChem CID 176542682) has the molecular formula C17H43N5O3 and a molecular weight of 365.56 g/mol. Its IUPAC name is 1,1-dimethyl-3-(N'-methylcarbamimidoyl)guanidine;methane;(3R,4R,5R,6S)-3-methylnonane-4,5,6-triol.
| Compound Name | 1,1-dimethyl-3-(N'-methylcarbamimidoyl)guanidine;methane;(3R,4R,5R,6S)-3-methylnonane-4,5,6-triol |
|---|---|
| PubChem CID | 176542682 |
| Molecular Formula | C17H43N5O3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.34 |
| IUPAC Name | 1,1-dimethyl-3-(N'-methylcarbamimidoyl)guanidine;methane;(3R,4R,5R,6S)-3-methylnonane-4,5,6-triol |
| SMILES | C.C.CCC[C@H](O)[C@@H](O)[C@H](O)[C@H](C)CC.[H]/N=C(/N/C(N)=N/C)N(C)C |
| InChI | InChI=1S/C10H22O3.C5H13N5.2CH4/c1-4-6-8(11)10(13)9(12)7(3)5-2;1-8-4(6)9-5(7)10(2)3;;/h7-13H,4-6H2,1-3H3;1-3H3,(H4,6,7,8,9);2*1H4/t7-,8+,9-,10-;;;/m1.../s1 |
| InChIKey | LWEXIWADCXWWRZ-CNKWTUTJSA-N |
| XLogP | 1.20 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|