C12H16F6O2 — CID 176591355
3,3,4,4,5,5-hexafluoro-1-(5-methoxypentoxy)-2-methylcyclopentene (PubChem CID 176591355) has the molecular formula C12H16F6O2 and a molecular weight of 306.25 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(5-methoxypentoxy)-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(5-methoxypentoxy)-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591355 |
| Molecular Formula | C12H16F6O2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(5-methoxypentoxy)-2-methylcyclopentene |
| SMILES | COCCCCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H16F6O2/c1-8-9(20-7-5-3-4-6-19-2)11(15,16)12(17,18)10(8,13)14/h3-7H2,1-2H3 |
| InChIKey | BKQKPZUOSWMNEH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|