C18H24ClN5O4S — CID 176597300
3-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridine (PubChem CID 176597300) has the molecular formula C18H24ClN5O4S and a molecular weight of 441.94 g/mol. Its IUPAC name is 3-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridine.
| Compound Name | 3-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridine |
|---|---|
| PubChem CID | 176597300 |
| Molecular Formula | C18H24ClN5O4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 3-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridine |
| SMILES | COC[C@@](C)(N=[N+]=[N-])c1cc2cc(Cl)ncc2c(O[C@H](C)C[C@@H](C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C18H24ClN5O4S/c1-11(6-12(2)29(5,25)26)28-17-14-9-21-16(19)8-13(14)7-15(22-17)18(3,10-27-4)23-24-20/h7-9,11-12H,6,10H2,1-5H3/t11-,12-,18-/m1/s1 |
| InChIKey | PHTSKQINFGRLRT-SEDUGSJDSA-N |
| XLogP | 4.05 |
| TPSA | 127.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|