C35H34N3OPtS- — CID 176605869
2-[(8-tert-butyl-5-methyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)sulfanyl]-4-methyl-7-propan-2-ylquinolin-8-ol;platinum (PubChem CID 176605869) has the molecular formula C35H34N3OPtS- and a molecular weight of 739.82 g/mol. Its IUPAC name is 2-[(8-tert-butyl-5-methyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)sulfanyl]-4-methyl-7-propan-2-ylquinolin-8-ol;platinum.
| Compound Name | 2-[(8-tert-butyl-5-methyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)sulfanyl]-4-methyl-7-propan-2-ylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176605869 |
| Molecular Formula | C35H34N3OPtS- |
| Molecular Weight | 739.82 g/mol |
| Exact Mass | 739.21 |
| IUPAC Name | 2-[(8-tert-butyl-5-methyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)sulfanyl]-4-methyl-7-propan-2-ylquinolin-8-ol;platinum |
| SMILES | Cc1cc(Sc2[c-]c3c(cc2)c2c(C)ccc(C(C)(C)C)c2n3-c2ccccn2)nc2c(O)c(C(C)C)ccc12.[Pt] |
| InChI | InChI=1S/C35H34N3OS.Pt/c1-20(2)24-14-15-25-22(4)18-30(37-32(25)34(24)39)40-23-12-13-26-28(19-23)38(29-10-8-9-17-36-29)33-27(35(5,6)7)16-11-21(3)31(26)33;/h8-18,20,39H,1-7H3;/q-1; |
| InChIKey | HDUSYJUVHRHSLK-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.82 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|