C48H55Cl2FN8O6 — CID 176612345
CID 176612345 (PubChem CID 176612345) has the molecular formula C48H55Cl2FN8O6 and a molecular weight of 929.92 g/mol.
| Compound Name | CID 176612345 |
|---|---|
| PubChem CID | 176612345 |
| Molecular Formula | C48H55Cl2FN8O6 |
| Molecular Weight | 929.92 g/mol |
| Exact Mass | 928.36 |
| IUPAC Name | — |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C3CCN(C[C@@H]4CC[C@@H](NC(=O)[C@@H]5NC6(CCC(C)(C)CC6)[C@@]6(C(=O)Nc7cc(Cl)ccc76)[C@H]5c5ccnc(Cl)c5F)CO4)CC3)cc21 |
| InChI | InChI=1S/C48H55Cl2FN8O6/c1-46(2)15-17-47(18-16-46)48(32-8-5-28(49)23-33(32)54-44(48)63)38(31-12-19-52-41(50)39(31)51)40(56-47)43(62)53-29-6-7-30(65-25-29)24-58-20-13-26(14-21-58)27-4-9-34-36(22-27)57(3)45(64)59(34)35-10-11-37(60)55-42(35)61/h4-5,8-9,12,19,22-23,26,29-30,35,38,40,56H,6-7,10-11,13-18,20-21,24-25H2,1-3H3,(H,53,62)(H,54,63)(H,55,60,61)/t29-,30+,35?,38+,40-,48-/m1/s1 |
| InChIKey | SDUWUZKKJLYXIA-VJJNFMNHSA-N |
| XLogP | 5.99 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.92 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|