C21H30N3O6P — CID 176616199
butyl (2S)-2-[[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 176616199) has the molecular formula C21H30N3O6P and a molecular weight of 451.46 g/mol. Its IUPAC name is butyl (2S)-2-[[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 176616199 |
| Molecular Formula | C21H30N3O6P |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | butyl (2S)-2-[[[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OCc1cnc(C)c(O)c1CN)Oc1ccccc1 |
| InChI | InChI=1S/C21H30N3O6P/c1-4-5-11-28-21(26)16(3)24-31(27,30-18-9-7-6-8-10-18)29-14-17-13-23-15(2)20(25)19(17)12-22/h6-10,13,16,25H,4-5,11-12,14,22H2,1-3H3,(H,24,27)/t16-,31?/m0/s1 |
| InChIKey | CLUDQNVVUXFWSJ-YDIHDLSKSA-N |
| XLogP | 3.58 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|