C35H40N6O7 — CID 176620816
[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2,6-dimethyl-4-(pyrrolidine-2-carbonyl)piperazine-1-carboxylate (PubChem CID 176620816) has the molecular formula C35H40N6O7 and a molecular weight of 656.74 g/mol. Its IUPAC name is [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2,6-dimethyl-4-(pyrrolidine-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2,6-dimethyl-4-(pyrrolidine-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176620816 |
| Molecular Formula | C35H40N6O7 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2,6-dimethyl-4-(pyrrolidine-2-carbonyl)piperazine-1-carboxylate |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(OC(=O)N4C(C)CN(C(=O)C5CCCN5)CC4C)ccc32)cc1 |
| InChI | InChI=1S/C35H40N6O7/c1-20-18-37(31(43)28-7-6-15-36-28)19-21(2)39(20)34(46)47-25-12-13-26-29(17-25)48-35(4,5)27-14-16-38-32(44)40(33(45)41(38)30(26)27)24-10-8-23(9-11-24)22(3)42/h8-14,17,20-21,28,30,36H,6-7,15-16,18-19H2,1-5H3 |
| InChIKey | HLVDZWSDDIONFS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|