C32H24N3OY- — CID 176652023
8-[4-methyl-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)benzene-2-id-1-yl]-9,9a-dihydro-5aH-benzo[g][1,3]benzoxazol-9-ide;yttrium (PubChem CID 176652023) has the molecular formula C32H24N3OY- and a molecular weight of 555.47 g/mol. Its IUPAC name is 8-[4-methyl-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)benzene-2-id-1-yl]-9,9a-dihydro-5aH-benzo[g][1,3]benzoxazol-9-ide;yttrium.
| Compound Name | 8-[4-methyl-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)benzene-2-id-1-yl]-9,9a-dihydro-5aH-benzo[g][1,3]benzoxazol-9-ide;yttrium |
|---|---|
| PubChem CID | 176652023 |
| Molecular Formula | C32H24N3OY- |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 8-[4-methyl-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)benzene-2-id-1-yl]-9,9a-dihydro-5aH-benzo[g][1,3]benzoxazol-9-ide;yttrium |
| SMILES | Cc1ccc(C2=[C-]C3c4ocnc4C=CC3C=C2)[c-]c1-c1n(-c2ccccc2)c2ccccc2[n+]1C.[Y] |
| InChI | InChI=1S/C32H24N3O.Y/c1-21-12-13-23(24-15-14-22-16-17-28-31(27(22)19-24)36-20-33-28)18-26(21)32-34(2)29-10-6-7-11-30(29)35(32)25-8-4-3-5-9-25;/h3-17,20,22,27H,1-2H3;/q-1; |
| InChIKey | WFBYCVLSBIWICP-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|