C12H14F2S — CID 176666386
4,4-difluoro-7-propan-2-yl-2,3-dihydrothiochromene (PubChem CID 176666386) has the molecular formula C12H14F2S and a molecular weight of 228.31 g/mol. Its IUPAC name is 4,4-difluoro-7-propan-2-yl-2,3-dihydrothiochromene.
| Compound Name | 4,4-difluoro-7-propan-2-yl-2,3-dihydrothiochromene |
|---|---|
| PubChem CID | 176666386 |
| Molecular Formula | C12H14F2S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4,4-difluoro-7-propan-2-yl-2,3-dihydrothiochromene |
| SMILES | CC(C)c1ccc2c(c1)SCCC2(F)F |
| InChI | InChI=1S/C12H14F2S/c1-8(2)9-3-4-10-11(7-9)15-6-5-12(10,13)14/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | TUCJEEVPMYGOJT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |