About 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol
1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol (PubChem CID 176677721) has the molecular formula C19H25NOS
and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol.
Molecular Properties
| Compound Name | 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol |
| PubChem CID | 176677721 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol |
| SMILES | C=C(N)c1ccc(C(C)=O)cc1.CC.Cc1ccccc1S |
| InChI | InChI=1S/C10H11NO.C7H8S.C2H6/c1-7(11)9-3-5-10(6-4-9)8(2)12;1-6-4-2-3-5-7(6)8;1-2/h3-6H,1,11H2,2H3;2-5,8H,1H3;1-2H3 |
| InChIKey | AVXWYBABOLDLKB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol?
The IUPAC name of 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol (CID 176677721) is 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol.
What is the SMILES notation for 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol?
The canonical SMILES for 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol is C=C(N)c1ccc(C(C)=O)cc1.CC.Cc1ccccc1S.
What is the InChIKey of 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol?
The InChIKey is AVXWYBABOLDLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C7H8S.C2H6/c1-7(11)9-3-5-10(6-4-9)8(2)12;1-6-4-2-3-5-7(6)8;1-2/h3-6H,1,11H2,2H3;2-5,8H,1H3;1-2H3.
What are the key properties of 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol?
1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol has a molecular weight of 315.48 g/mol, XLogP of 5.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-aminoethenyl)phenyl]ethanone;ethane;2-methylbenzenethiol is sourced from PubChem (CID 176677721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).