C28H23N3O7 — CID 176691657
3-[[[2-[1-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]methyl]-4-phenylbenzoic acid (PubChem CID 176691657) has the molecular formula C28H23N3O7 and a molecular weight of 513.51 g/mol. Its IUPAC name is 3-[[[2-[1-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]methyl]-4-phenylbenzoic acid.
| Compound Name | 3-[[[2-[1-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]methyl]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 176691657 |
| Molecular Formula | C28H23N3O7 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 3-[[[2-[1-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]methyl]-4-phenylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)c(CNc2cccc3c2C(=O)N(C2CCC(=O)N(CO)C2=O)C3=O)c1 |
| InChI | InChI=1S/C28H23N3O7/c32-15-30-23(33)12-11-22(26(30)35)31-25(34)20-7-4-8-21(24(20)27(31)36)29-14-18-13-17(28(37)38)9-10-19(18)16-5-2-1-3-6-16/h1-10,13,22,29,32H,11-12,14-15H2,(H,37,38) |
| InChIKey | WAQSQXAYKRPYSJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|