C13H23NO3S — CID 176700823
(Z)-3-ethenyl-6,6-dimethyl-5-methylidene-N-methylsulfonylhept-3-enamide;molecular hydrogen (PubChem CID 176700823) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is (Z)-3-ethenyl-6,6-dimethyl-5-methylidene-N-methylsulfonylhept-3-enamide;molecular hydrogen.
| Compound Name | (Z)-3-ethenyl-6,6-dimethyl-5-methylidene-N-methylsulfonylhept-3-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 176700823 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (Z)-3-ethenyl-6,6-dimethyl-5-methylidene-N-methylsulfonylhept-3-enamide;molecular hydrogen |
| SMILES | C=C/C(=C\C(=C)C(C)(C)C)CC(=O)NS(C)(=O)=O.[H][H] |
| InChI | InChI=1S/C13H21NO3S.H2/c1-7-11(8-10(2)13(3,4)5)9-12(15)14-18(6,16)17;/h7-8H,1-2,9H2,3-6H3,(H,14,15);1H/b11-8+; |
| InChIKey | FGCXTJFCPOHUPP-YGCVIUNWSA-N |
| XLogP | 2.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|