C10H15F3N2 — CID 176704957
(Z)-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine (PubChem CID 176704957) has the molecular formula C10H15F3N2 and a molecular weight of 220.24 g/mol. Its IUPAC name is (Z)-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine.
| Compound Name | (Z)-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine |
|---|---|
| PubChem CID | 176704957 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (Z)-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine |
| SMILES | C/C=C(N)\N=C(/C=C/CCC)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2/c1-3-5-6-7-8(10(11,12)13)15-9(14)4-2/h4,6-7H,3,5,14H2,1-2H3/b7-6+,9-4-,15-8+ |
| InChIKey | QNRHFZHLFMIVBI-KNUCLHGBSA-N |
| XLogP | 3.17 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|