C9H13F3N2 — CID 177356972
(E)-1-[(E)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-1-en-1-amine (PubChem CID 177356972) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is (E)-1-[(E)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-1-en-1-amine.
| Compound Name | (E)-1-[(E)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-1-en-1-amine |
|---|---|
| PubChem CID | 177356972 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (E)-1-[(E)-[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-1-en-1-amine |
| SMILES | C/C=C\C(=N/C(N)=C/CC)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2/c1-3-5-7(9(10,11)12)14-8(13)6-4-2/h3,5-6H,4,13H2,1-2H3/b5-3-,8-6+,14-7+ |
| InChIKey | ILDVINQPLQXWDO-DIRBERQESA-N |
| XLogP | 2.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|