C19H18F3N3O6S — CID 176714163
tert-butyl 7-cyano-8-methoxy-4-(trifluoromethylsulfonyloxy)-1,3-dihydropyrrolo[3,4-c]quinoline-2-carboxylate (PubChem CID 176714163) has the molecular formula C19H18F3N3O6S and a molecular weight of 473.43 g/mol. Its IUPAC name is tert-butyl 7-cyano-8-methoxy-4-(trifluoromethylsulfonyloxy)-1,3-dihydropyrrolo[3,4-c]quinoline-2-carboxylate.
| Compound Name | tert-butyl 7-cyano-8-methoxy-4-(trifluoromethylsulfonyloxy)-1,3-dihydropyrrolo[3,4-c]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 176714163 |
| Molecular Formula | C19H18F3N3O6S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | tert-butyl 7-cyano-8-methoxy-4-(trifluoromethylsulfonyloxy)-1,3-dihydropyrrolo[3,4-c]quinoline-2-carboxylate |
| SMILES | COc1cc2c3c(c(OS(=O)(=O)C(F)(F)F)nc2cc1C#N)CN(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C19H18F3N3O6S/c1-18(2,3)30-17(26)25-8-12-11-6-15(29-4)10(7-23)5-14(11)24-16(13(12)9-25)31-32(27,28)19(20,21)22/h5-6H,8-9H2,1-4H3 |
| InChIKey | DJLGGADYCVSBOI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 118.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|