C11H18N2 — CID 176717878
ethane;3-methyl-5,6,7,8-tetrahydrocinnoline (PubChem CID 176717878) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;3-methyl-5,6,7,8-tetrahydrocinnoline.
| Compound Name | ethane;3-methyl-5,6,7,8-tetrahydrocinnoline |
|---|---|
| PubChem CID | 176717878 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;3-methyl-5,6,7,8-tetrahydrocinnoline |
| SMILES | CC.Cc1cc2c(nn1)CCCC2 |
| InChI | InChI=1S/C9H12N2.C2H6/c1-7-6-8-4-2-3-5-9(8)11-10-7;1-2/h6H,2-5H2,1H3;1-2H3 |
| InChIKey | PTPDWWQTMOLJRT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |