C31H33NO10 — CID 176738128
[(1S,4S,7R,8S,9R,11S)-9-tert-butyl-5-[(2,4-dimethoxyphenyl)methyl]-9-hydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate (PubChem CID 176738128) has the molecular formula C31H33NO10 and a molecular weight of 579.60 g/mol. Its IUPAC name is [(1S,4S,7R,8S,9R,11S)-9-tert-butyl-5-[(2,4-dimethoxyphenyl)methyl]-9-hydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate.
| Compound Name | [(1S,4S,7R,8S,9R,11S)-9-tert-butyl-5-[(2,4-dimethoxyphenyl)methyl]-9-hydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate |
|---|---|
| PubChem CID | 176738128 |
| Molecular Formula | C31H33NO10 |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | [(1S,4S,7R,8S,9R,11S)-9-tert-butyl-5-[(2,4-dimethoxyphenyl)methyl]-9-hydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate |
| SMILES | COc1ccc(CN2C(=O)[C@H](OC(=O)c3ccccc3)[C@@]34[C@@H]2OC(=O)[C@@]32CC(=O)O[C@H]2C[C@@]4(O)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C31H33NO10/c1-28(2,3)30(37)14-21-29(15-22(33)40-21)27(36)42-26-31(29,30)23(41-25(35)17-9-7-6-8-10-17)24(34)32(26)16-18-11-12-19(38-4)13-20(18)39-5/h6-13,21,23,26,37H,14-16H2,1-5H3/t21-,23-,26-,29-,30+,31+/m0/s1 |
| InChIKey | MBIUILQSBMZLHO-NUHAVQHZSA-N |
| XLogP | 2.62 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|