C26H29NO9 — CID 176738230
[(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-(oxetan-3-ylmethyl)-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate (PubChem CID 176738230) has the molecular formula C26H29NO9 and a molecular weight of 499.52 g/mol. Its IUPAC name is [(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-(oxetan-3-ylmethyl)-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate.
| Compound Name | [(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-(oxetan-3-ylmethyl)-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate |
|---|---|
| PubChem CID | 176738230 |
| Molecular Formula | C26H29NO9 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | [(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-(oxetan-3-ylmethyl)-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate |
| SMILES | CC(C)(C)[C@]1(O)C[C@@H]2OC(=O)C[C@@]23C(=O)O[C@@H]2N(CC4COC4)C(=O)C(OC(=O)c4ccccc4)C213 |
| InChI | InChI=1S/C26H29NO9/c1-23(2,3)25(32)9-16-24(10-17(28)34-16)22(31)36-21-26(24,25)18(19(29)27(21)11-14-12-33-13-14)35-20(30)15-7-5-4-6-8-15/h4-8,14,16,18,21,32H,9-13H2,1-3H3/t16-,18?,21-,24-,25+,26?/m0/s1 |
| InChIKey | BTNIRZFCUVFJCP-STGZSMOISA-N |
| XLogP | 1.05 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|