C14H14O4S — CID 176765733
3-propan-2-ylbenzo[h][2,4,1]benzodioxathiine 1,1-dioxide (PubChem CID 176765733) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-propan-2-ylbenzo[h][2,4,1]benzodioxathiine 1,1-dioxide.
| Compound Name | 3-propan-2-ylbenzo[h][2,4,1]benzodioxathiine 1,1-dioxide |
|---|---|
| PubChem CID | 176765733 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-propan-2-ylbenzo[h][2,4,1]benzodioxathiine 1,1-dioxide |
| SMILES | CC(C)C1Oc2ccc3ccccc3c2S(=O)(=O)O1 |
| InChI | InChI=1S/C14H14O4S/c1-9(2)14-17-12-8-7-10-5-3-4-6-11(10)13(12)19(15,16)18-14/h3-9,14H,1-2H3 |
| InChIKey | QXDWGZMULLOOBY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|