C28H47NO6 — CID 176815958
N-benzyl-N-[(2R,3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-methoxyoxan-3-yl]acetamide (PubChem CID 176815958) has the molecular formula C28H47NO6 and a molecular weight of 493.69 g/mol. Its IUPAC name is N-benzyl-N-[(2R,3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-methoxyoxan-3-yl]acetamide.
| Compound Name | N-benzyl-N-[(2R,3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-methoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 176815958 |
| Molecular Formula | C28H47NO6 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.34 |
| IUPAC Name | N-benzyl-N-[(2R,3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-2-methoxyoxan-3-yl]acetamide |
| SMILES | CCCCOC[C@H]1O[C@@H](OC)[C@@H](N(Cc2ccccc2)C(C)=O)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C28H47NO6/c1-6-9-17-32-21-24-26(33-18-10-7-2)27(34-19-11-8-3)25(28(31-5)35-24)29(22(4)30)20-23-15-13-12-14-16-23/h12-16,24-28H,6-11,17-21H2,1-5H3/t24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | MLEFEKTYXINCAQ-QBROEMLDSA-N |
| XLogP | 4.96 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|