About (2S)-3,3-dideuterio-4-methylpentan-2-ol
(2S)-3,3-dideuterio-4-methylpentan-2-ol (PubChem CID 176842427) has the molecular formula C6H14O
and a molecular weight of 104.19 g/mol. Its IUPAC name is (2S)-3,3-dideuterio-4-methylpentan-2-ol.
Molecular Properties
| Compound Name | (2S)-3,3-dideuterio-4-methylpentan-2-ol |
| PubChem CID | 176842427 |
| Molecular Formula | C6H14O |
| Molecular Weight | 104.19 g/mol |
| Exact Mass | 104.12 |
| IUPAC Name | (2S)-3,3-dideuterio-4-methylpentan-2-ol |
| SMILES | [2H]C([2H])(C(C)C)[C@H](C)O |
| InChI | InChI=1S/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3/t6-/m0/s1/i4D2 |
| InChIKey | WVYWICLMDOOCFB-JRHBLRTESA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-3,3-dideuterio-4-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dideuterio-4-methylpentan-2-ol?
The IUPAC name of (2S)-3,3-dideuterio-4-methylpentan-2-ol (CID 176842427) is (2S)-3,3-dideuterio-4-methylpentan-2-ol.
What is the SMILES notation for (2S)-3,3-dideuterio-4-methylpentan-2-ol?
The canonical SMILES for (2S)-3,3-dideuterio-4-methylpentan-2-ol is [2H]C([2H])(C(C)C)[C@H](C)O.
What is the InChIKey of (2S)-3,3-dideuterio-4-methylpentan-2-ol?
The InChIKey is WVYWICLMDOOCFB-JRHBLRTESA-N. The full InChI is InChI=1S/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3/t6-/m0/s1/i4D2.
What are the key properties of (2S)-3,3-dideuterio-4-methylpentan-2-ol?
(2S)-3,3-dideuterio-4-methylpentan-2-ol has a molecular weight of 104.19 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dideuterio-4-methylpentan-2-ol is sourced from PubChem (CID 176842427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).